About dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane
dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane (PubChem CID 174857155) has the molecular formula C12H26NS+
and a molecular weight of 216.41 g/mol. Its IUPAC name is dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane.
Molecular Properties
| Compound Name | dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane |
| PubChem CID | 174857155 |
| Molecular Formula | C12H26NS+ |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane |
| SMILES | C=CC[N+](C)(C)CC=C.CCSCC |
| InChI | InChI=1S/C8H16N.C4H10S/c1-5-7-9(3,4)8-6-2;1-3-5-4-2/h5-6H,1-2,7-8H2,3-4H3;3-4H2,1-2H3/q+1; |
| InChIKey | ILCAPDFKYJBTKC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane?
The IUPAC name of dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane (CID 174857155) is dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane.
What is the SMILES notation for dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane?
The canonical SMILES for dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane is C=CC[N+](C)(C)CC=C.CCSCC.
What is the InChIKey of dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane?
The InChIKey is ILCAPDFKYJBTKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N.C4H10S/c1-5-7-9(3,4)8-6-2;1-3-5-4-2/h5-6H,1-2,7-8H2,3-4H3;3-4H2,1-2H3/q+1;.
What are the key properties of dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane?
dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane has a molecular weight of 216.41 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(prop-2-enyl)azanium;ethylsulfanylethane is sourced from PubChem (CID 174857155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).