About diphenyldiazene;hydrofluoride
diphenyldiazene;hydrofluoride (PubChem CID 174857584) has the molecular formula C12H11FN2
and a molecular weight of 202.23 g/mol. Its IUPAC name is diphenyldiazene;hydrofluoride.
Molecular Properties
| Compound Name | diphenyldiazene;hydrofluoride |
| PubChem CID | 174857584 |
| Molecular Formula | C12H11FN2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | diphenyldiazene;hydrofluoride |
| SMILES | F.c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10N2.FH/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-10H;1H/b14-13+; |
| InChIKey | NMHSYGGMGYBSNB-IERUDJENSA-N |
| XLogP | 4.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze diphenyldiazene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyldiazene;hydrofluoride?
The IUPAC name of diphenyldiazene;hydrofluoride (CID 174857584) is diphenyldiazene;hydrofluoride.
What is the SMILES notation for diphenyldiazene;hydrofluoride?
The canonical SMILES for diphenyldiazene;hydrofluoride is F.c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of diphenyldiazene;hydrofluoride?
The InChIKey is NMHSYGGMGYBSNB-IERUDJENSA-N. The full InChI is InChI=1S/C12H10N2.FH/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h1-10H;1H/b14-13+;.
What are the key properties of diphenyldiazene;hydrofluoride?
diphenyldiazene;hydrofluoride has a molecular weight of 202.23 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyldiazene;hydrofluoride is sourced from PubChem (CID 174857584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).