C14H16O6 — CID 174857706
3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxepane-2,7-dione (PubChem CID 174857706) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxepane-2,7-dione.
| Compound Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxepane-2,7-dione |
|---|---|
| PubChem CID | 174857706 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;oxepane-2,7-dione |
| SMILES | O=C1CCCCC(=O)O1.O=C1OC(=O)C2CCC=CC12 |
| InChI | InChI=1S/C8H8O3.C6H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7;7-5-3-1-2-4-6(8)9-5/h1,3,5-6H,2,4H2;1-4H2 |
| InChIKey | WHIWDINVVKMNLY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|