About 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene
1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene (PubChem CID 174857754) has the molecular formula C12H8Cl2FNO2
and a molecular weight of 288.10 g/mol. Its IUPAC name is 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene |
| PubChem CID | 174857754 |
| Molecular Formula | C12H8Cl2FNO2 |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene |
| SMILES | O=[N+]([O-])C1(F)C=C(Cl)C(c2ccccc2)=C(Cl)C1 |
| InChI | InChI=1S/C12H8Cl2FNO2/c13-9-6-12(15,16(17)18)7-10(14)11(9)8-4-2-1-3-5-8/h1-6H,7H2 |
| InChIKey | BRBHVCNXCVGSBC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene?
The IUPAC name of 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene (CID 174857754) is 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene.
What is the SMILES notation for 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene?
The canonical SMILES for 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene is O=[N+]([O-])C1(F)C=C(Cl)C(c2ccccc2)=C(Cl)C1.
What is the InChIKey of 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene?
The InChIKey is BRBHVCNXCVGSBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2FNO2/c13-9-6-12(15,16(17)18)7-10(14)11(9)8-4-2-1-3-5-8/h1-6H,7H2.
What are the key properties of 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene?
1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene has a molecular weight of 288.10 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-fluoro-5-nitro-2-phenylcyclohexa-1,3-diene is sourced from PubChem (CID 174857754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).