About ethanol;pentalene
ethanol;pentalene (PubChem CID 174858508) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is ethanol;pentalene.
Molecular Properties
| Compound Name | ethanol;pentalene |
| PubChem CID | 174858508 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | ethanol;pentalene |
| SMILES | C1=CC2=CC=CC2=C1.CCO |
| InChI | InChI=1S/C8H6.C2H6O/c1-3-7-5-2-6-8(7)4-1;1-2-3/h1-6H;3H,2H2,1H3 |
| InChIKey | CQMZPRVKRVQOSI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanol;pentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;pentalene?
The IUPAC name of ethanol;pentalene (CID 174858508) is ethanol;pentalene.
What is the SMILES notation for ethanol;pentalene?
The canonical SMILES for ethanol;pentalene is C1=CC2=CC=CC2=C1.CCO.
What is the InChIKey of ethanol;pentalene?
The InChIKey is CQMZPRVKRVQOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6.C2H6O/c1-3-7-5-2-6-8(7)4-1;1-2-3/h1-6H;3H,2H2,1H3.
What are the key properties of ethanol;pentalene?
ethanol;pentalene has a molecular weight of 148.20 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;pentalene is sourced from PubChem (CID 174858508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).