C34H30 — CID 174858914
anthracene;6-ethyl-1,2,3,4-tetrahydrochrysene (PubChem CID 174858914) has the molecular formula C34H30 and a molecular weight of 438.61 g/mol. Its IUPAC name is anthracene;6-ethyl-1,2,3,4-tetrahydrochrysene.
| Compound Name | anthracene;6-ethyl-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174858914 |
| Molecular Formula | C34H30 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | anthracene;6-ethyl-1,2,3,4-tetrahydrochrysene |
| SMILES | CCc1cc2c3c(ccc2c2ccccc12)CCCC3.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C20H20.C14H10/c1-2-14-13-20-17-9-4-3-7-15(17)11-12-19(20)18-10-6-5-8-16(14)18;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h5-6,8,10-13H,2-4,7,9H2,1H3;1-10H |
| InChIKey | BSSPSKJPKPUVEL-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|