About 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline
2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline (PubChem CID 174859269) has the molecular formula C22H22N2S
and a molecular weight of 346.50 g/mol. Its IUPAC name is 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline.
Molecular Properties
| Compound Name | 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline |
| PubChem CID | 174859269 |
| Molecular Formula | C22H22N2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline |
| SMILES | CC1=C(C)Sc2ccccc2N1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C10H11NS/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7-8(2)12-10-6-4-3-5-9(10)11-7/h1-10,13H;3-6,11H,1-2H3 |
| InChIKey | AZJUMASHNOGQEG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline?
The IUPAC name of 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline (CID 174859269) is 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline.
What is the SMILES notation for 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline?
The canonical SMILES for 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline is CC1=C(C)Sc2ccccc2N1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline?
The InChIKey is AZJUMASHNOGQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C10H11NS/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7-8(2)12-10-6-4-3-5-9(10)11-7/h1-10,13H;3-6,11H,1-2H3.
What are the key properties of 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline?
2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline has a molecular weight of 346.50 g/mol, XLogP of 6.89, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4H-1,4-benzothiazine;N-phenylaniline is sourced from PubChem (CID 174859269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).