C18H24O4 — CID 174859350
benzene;2,2-diethoxy-1-phenylethanone;hydrate (PubChem CID 174859350) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzene;2,2-diethoxy-1-phenylethanone;hydrate.
| Compound Name | benzene;2,2-diethoxy-1-phenylethanone;hydrate |
|---|---|
| PubChem CID | 174859350 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | benzene;2,2-diethoxy-1-phenylethanone;hydrate |
| SMILES | CCOC(OCC)C(=O)c1ccccc1.O.c1ccccc1 |
| InChI | InChI=1S/C12H16O3.C6H6.H2O/c1-3-14-12(15-4-2)11(13)10-8-6-5-7-9-10;1-2-4-6-5-3-1;/h5-9,12H,3-4H2,1-2H3;1-6H;1H2 |
| InChIKey | BPJKWAHNTVAEPX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|