About tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole
tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole (PubChem CID 174860400) has the molecular formula C16H23NO5S
and a molecular weight of 341.43 g/mol. Its IUPAC name is tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole |
| PubChem CID | 174860400 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole |
| SMILES | CC(C)(C)OC(=O)O.O=S(=O)(c1ccc2c(c1)CNC2)C1CC1 |
| InChI | InChI=1S/C11H13NO2S.C5H10O3/c13-15(14,10-3-4-10)11-2-1-8-6-12-7-9(8)5-11;1-5(2,3)8-4(6)7/h1-2,5,10,12H,3-4,6-7H2;1-3H3,(H,6,7) |
| InChIKey | FSNUSUHBJAGHTK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole?
The IUPAC name of tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole (CID 174860400) is tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole.
What is the SMILES notation for tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole?
The canonical SMILES for tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole is CC(C)(C)OC(=O)O.O=S(=O)(c1ccc2c(c1)CNC2)C1CC1.
What is the InChIKey of tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole?
The InChIKey is FSNUSUHBJAGHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S.C5H10O3/c13-15(14,10-3-4-10)11-2-1-8-6-12-7-9(8)5-11;1-5(2,3)8-4(6)7/h1-2,5,10,12H,3-4,6-7H2;1-3H3,(H,6,7).
What are the key properties of tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole?
tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole has a molecular weight of 341.43 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl hydrogen carbonate;5-cyclopropylsulfonyl-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 174860400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).