tricarbonochloridoylsilylformyl chloride

C4Cl4O4Si — CID 174860446

IUPACtricarbonochloridoylsilylformyl chloride
SMILESO=C(Cl)[Si](C(=O)Cl)(C(=O)Cl)C(=O)Cl
InChIInChI=1S/C4Cl4O4Si/c5-1(9)13(2(6)10,3(7)11)4(8)12
InChIKeyQRPSQZLTESUNEJ-UHFFFAOYSA-N
MW281.94 g/mol
LogP3.20
Rot. Bonds4

About tricarbonochloridoylsilylformyl chloride

tricarbonochloridoylsilylformyl chloride (PubChem CID 174860446) has the molecular formula C4Cl4O4Si and a molecular weight of 281.94 g/mol. Its IUPAC name is tricarbonochloridoylsilylformyl chloride.

Molecular Properties

Compound Nametricarbonochloridoylsilylformyl chloride
PubChem CID174860446
Molecular FormulaC4Cl4O4Si
Molecular Weight281.94 g/mol
Exact Mass279.83
IUPAC Nametricarbonochloridoylsilylformyl chloride
SMILESO=C(Cl)[Si](C(=O)Cl)(C(=O)Cl)C(=O)Cl
InChIInChI=1S/C4Cl4O4Si/c5-1(9)13(2(6)10,3(7)11)4(8)12
InChIKeyQRPSQZLTESUNEJ-UHFFFAOYSA-N
XLogP3.20
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.94
LogP ≤ 53.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze tricarbonochloridoylsilylformyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tricarbonochloridoylsilylformyl chloride?
The IUPAC name of tricarbonochloridoylsilylformyl chloride (CID 174860446) is tricarbonochloridoylsilylformyl chloride.
What is the SMILES notation for tricarbonochloridoylsilylformyl chloride?
The canonical SMILES for tricarbonochloridoylsilylformyl chloride is O=C(Cl)[Si](C(=O)Cl)(C(=O)Cl)C(=O)Cl.
What is the InChIKey of tricarbonochloridoylsilylformyl chloride?
The InChIKey is QRPSQZLTESUNEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4Cl4O4Si/c5-1(9)13(2(6)10,3(7)11)4(8)12.
What are the key properties of tricarbonochloridoylsilylformyl chloride?
tricarbonochloridoylsilylformyl chloride has a molecular weight of 281.94 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tricarbonochloridoylsilylformyl chloride is sourced from PubChem (CID 174860446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).