About 1-bromo-2,3-dimethylindole-7-carboxamide
1-bromo-2,3-dimethylindole-7-carboxamide (PubChem CID 174861144) has the molecular formula C11H11BrN2O
and a molecular weight of 267.13 g/mol. Its IUPAC name is 1-bromo-2,3-dimethylindole-7-carboxamide.
Molecular Properties
| Compound Name | 1-bromo-2,3-dimethylindole-7-carboxamide |
| PubChem CID | 174861144 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 1-bromo-2,3-dimethylindole-7-carboxamide |
| SMILES | Cc1c(C)n(Br)c2c(C(N)=O)cccc12 |
| InChI | InChI=1S/C11H11BrN2O/c1-6-7(2)14(12)10-8(6)4-3-5-9(10)11(13)15/h3-5H,1-2H3,(H2,13,15) |
| InChIKey | NAMVGZMPSSNZCB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-2,3-dimethylindole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3-dimethylindole-7-carboxamide?
The IUPAC name of 1-bromo-2,3-dimethylindole-7-carboxamide (CID 174861144) is 1-bromo-2,3-dimethylindole-7-carboxamide.
What is the SMILES notation for 1-bromo-2,3-dimethylindole-7-carboxamide?
The canonical SMILES for 1-bromo-2,3-dimethylindole-7-carboxamide is Cc1c(C)n(Br)c2c(C(N)=O)cccc12.
What is the InChIKey of 1-bromo-2,3-dimethylindole-7-carboxamide?
The InChIKey is NAMVGZMPSSNZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O/c1-6-7(2)14(12)10-8(6)4-3-5-9(10)11(13)15/h3-5H,1-2H3,(H2,13,15).
What are the key properties of 1-bromo-2,3-dimethylindole-7-carboxamide?
1-bromo-2,3-dimethylindole-7-carboxamide has a molecular weight of 267.13 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3-dimethylindole-7-carboxamide is sourced from PubChem (CID 174861144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).