C18H34O6Si2 — CID 174862070
[1,2,2-trimethoxy-1-[4-(1,2,2-trimethoxy-1-silylpropyl)phenyl]propyl]silane (PubChem CID 174862070) has the molecular formula C18H34O6Si2 and a molecular weight of 402.64 g/mol. Its IUPAC name is [1,2,2-trimethoxy-1-[4-(1,2,2-trimethoxy-1-silylpropyl)phenyl]propyl]silane.
| Compound Name | [1,2,2-trimethoxy-1-[4-(1,2,2-trimethoxy-1-silylpropyl)phenyl]propyl]silane |
|---|---|
| PubChem CID | 174862070 |
| Molecular Formula | C18H34O6Si2 |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [1,2,2-trimethoxy-1-[4-(1,2,2-trimethoxy-1-silylpropyl)phenyl]propyl]silane |
| SMILES | COC(C)(OC)C([SiH3])(OC)c1ccc(C([SiH3])(OC)C(C)(OC)OC)cc1 |
| InChI | InChI=1S/C18H34O6Si2/c1-15(19-3,20-4)17(25,23-7)13-9-11-14(12-10-13)18(26,24-8)16(2,21-5)22-6/h9-12H,1-8,25-26H3 |
| InChIKey | ULIFOZNMRLUMDZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|