About 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane (PubChem CID 174862298) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane |
| PubChem CID | 174862298 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane |
| SMILES | C1=CCC(C2=CC=CC2)=C1.COC |
| InChI | InChI=1S/C10H10.C2H6O/c1-2-6-9(5-1)10-7-3-4-8-10;1-3-2/h1-5,7H,6,8H2;1-2H3 |
| InChIKey | VWESHEOQHSQHPN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane?
The IUPAC name of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane (CID 174862298) is 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane is C1=CCC(C2=CC=CC2)=C1.COC.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane?
The InChIKey is VWESHEOQHSQHPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C2H6O/c1-2-6-9(5-1)10-7-3-4-8-10;1-3-2/h1-5,7H,6,8H2;1-2H3.
What are the key properties of 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane?
1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane has a molecular weight of 176.26 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-diene;methoxymethane is sourced from PubChem (CID 174862298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).