About benzene;1,1-difluoroethene;pyrrolidin-2-one
benzene;1,1-difluoroethene;pyrrolidin-2-one (PubChem CID 174862990) has the molecular formula C12H15F2NO
and a molecular weight of 227.25 g/mol. Its IUPAC name is benzene;1,1-difluoroethene;pyrrolidin-2-one.
Molecular Properties
| Compound Name | benzene;1,1-difluoroethene;pyrrolidin-2-one |
| PubChem CID | 174862990 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | benzene;1,1-difluoroethene;pyrrolidin-2-one |
| SMILES | C=C(F)F.O=C1CCCN1.c1ccccc1 |
| InChI | InChI=1S/C6H6.C4H7NO.C2H2F2/c1-2-4-6-5-3-1;6-4-2-1-3-5-4;1-2(3)4/h1-6H;1-3H2,(H,5,6);1H2 |
| InChIKey | DDYKZIDCUIFMMQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;1,1-difluoroethene;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,1-difluoroethene;pyrrolidin-2-one?
The IUPAC name of benzene;1,1-difluoroethene;pyrrolidin-2-one (CID 174862990) is benzene;1,1-difluoroethene;pyrrolidin-2-one.
What is the SMILES notation for benzene;1,1-difluoroethene;pyrrolidin-2-one?
The canonical SMILES for benzene;1,1-difluoroethene;pyrrolidin-2-one is C=C(F)F.O=C1CCCN1.c1ccccc1.
What is the InChIKey of benzene;1,1-difluoroethene;pyrrolidin-2-one?
The InChIKey is DDYKZIDCUIFMMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6.C4H7NO.C2H2F2/c1-2-4-6-5-3-1;6-4-2-1-3-5-4;1-2(3)4/h1-6H;1-3H2,(H,5,6);1H2.
What are the key properties of benzene;1,1-difluoroethene;pyrrolidin-2-one?
benzene;1,1-difluoroethene;pyrrolidin-2-one has a molecular weight of 227.25 g/mol, XLogP of 2.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,1-difluoroethene;pyrrolidin-2-one is sourced from PubChem (CID 174862990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).