About 2,3-diphenylpyrrol-2-ol;methane
2,3-diphenylpyrrol-2-ol;methane (PubChem CID 174863089) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,3-diphenylpyrrol-2-ol;methane.
Molecular Properties
| Compound Name | 2,3-diphenylpyrrol-2-ol;methane |
| PubChem CID | 174863089 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2,3-diphenylpyrrol-2-ol;methane |
| SMILES | C.OC1(c2ccccc2)N=CC=C1c1ccccc1 |
| InChI | InChI=1S/C16H13NO.CH4/c18-16(14-9-5-2-6-10-14)15(11-12-17-16)13-7-3-1-4-8-13;/h1-12,18H;1H4 |
| InChIKey | SZVSNSUHHSMJLP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diphenylpyrrol-2-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenylpyrrol-2-ol;methane?
The IUPAC name of 2,3-diphenylpyrrol-2-ol;methane (CID 174863089) is 2,3-diphenylpyrrol-2-ol;methane.
What is the SMILES notation for 2,3-diphenylpyrrol-2-ol;methane?
The canonical SMILES for 2,3-diphenylpyrrol-2-ol;methane is C.OC1(c2ccccc2)N=CC=C1c1ccccc1.
What is the InChIKey of 2,3-diphenylpyrrol-2-ol;methane?
The InChIKey is SZVSNSUHHSMJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO.CH4/c18-16(14-9-5-2-6-10-14)15(11-12-17-16)13-7-3-1-4-8-13;/h1-12,18H;1H4.
What are the key properties of 2,3-diphenylpyrrol-2-ol;methane?
2,3-diphenylpyrrol-2-ol;methane has a molecular weight of 251.33 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylpyrrol-2-ol;methane is sourced from PubChem (CID 174863089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).