C10H22N6O2 — CID 174863459
2-amino-5-(diaminomethylideneamino)pentanoic acid;1,2,3,4-tetrahydropyrimidine (PubChem CID 174863459) has the molecular formula C10H22N6O2 and a molecular weight of 258.33 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;1,2,3,4-tetrahydropyrimidine.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;1,2,3,4-tetrahydropyrimidine |
|---|---|
| PubChem CID | 174863459 |
| Molecular Formula | C10H22N6O2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;1,2,3,4-tetrahydropyrimidine |
| SMILES | C1=CNCNC1.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.C4H8N2/c7-4(5(11)12)2-1-3-10-6(8)9;1-2-5-4-6-3-1/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1-2,5-6H,3-4H2 |
| InChIKey | OYYZIIADRGGTEV-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|