About butanediamide;(Z)-but-2-enedioic acid
butanediamide;(Z)-but-2-enedioic acid (PubChem CID 174863707) has the molecular formula C8H12N2O6
and a molecular weight of 232.19 g/mol. Its IUPAC name is butanediamide;(Z)-but-2-enedioic acid.
Molecular Properties
| Compound Name | butanediamide;(Z)-but-2-enedioic acid |
| PubChem CID | 174863707 |
| Molecular Formula | C8H12N2O6 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | butanediamide;(Z)-but-2-enedioic acid |
| SMILES | NC(=O)CCC(N)=O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C4H8N2O2.C4H4O4/c5-3(7)1-2-4(6)8;5-3(6)1-2-4(7)8/h1-2H2,(H2,5,7)(H2,6,8);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QTHVWUCTALHKNQ-BTJKTKAUSA-N |
| XLogP | -1.55 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butanediamide;(Z)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanediamide;(Z)-but-2-enedioic acid?
The IUPAC name of butanediamide;(Z)-but-2-enedioic acid (CID 174863707) is butanediamide;(Z)-but-2-enedioic acid.
What is the SMILES notation for butanediamide;(Z)-but-2-enedioic acid?
The canonical SMILES for butanediamide;(Z)-but-2-enedioic acid is NC(=O)CCC(N)=O.O=C(O)/C=C\C(=O)O.
What is the InChIKey of butanediamide;(Z)-but-2-enedioic acid?
The InChIKey is QTHVWUCTALHKNQ-BTJKTKAUSA-N. The full InChI is InChI=1S/C4H8N2O2.C4H4O4/c5-3(7)1-2-4(6)8;5-3(6)1-2-4(7)8/h1-2H2,(H2,5,7)(H2,6,8);1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of butanediamide;(Z)-but-2-enedioic acid?
butanediamide;(Z)-but-2-enedioic acid has a molecular weight of 232.19 g/mol, XLogP of -1.55, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanediamide;(Z)-but-2-enedioic acid is sourced from PubChem (CID 174863707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).