C26H35NO4 — CID 174864038
cyclohex-2-en-1-one;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one (PubChem CID 174864038) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is cyclohex-2-en-1-one;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one.
| Compound Name | cyclohex-2-en-1-one;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 174864038 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | cyclohex-2-en-1-one;2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one |
| SMILES | CCO/N=C(\CC)C1=C(O)CC(c2c(C)cc(C)cc2C)CC1=O.O=C1C=CCCC1 |
| InChI | InChI=1S/C20H27NO3.C6H8O/c1-6-16(21-24-7-2)20-17(22)10-15(11-18(20)23)19-13(4)8-12(3)9-14(19)5;7-6-4-2-1-3-5-6/h8-9,15,22H,6-7,10-11H2,1-5H3;2,4H,1,3,5H2/b21-16+; |
| InChIKey | DFMHEAOOMHMICD-JEBHESKQSA-N |
| XLogP | 5.97 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|