About 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione
1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione (PubChem CID 174864881) has the molecular formula C7H9N3O2S
and a molecular weight of 199.23 g/mol. Its IUPAC name is 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione |
| PubChem CID | 174864881 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2CNCS2)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9N3O2S/c11-5-1-2-10(7(12)9-5)6-3-8-4-13-6/h1-2,6,8H,3-4H2,(H,9,11,12) |
| InChIKey | MMALYWALQDLQIJ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione?
The IUPAC name of 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione (CID 174864881) is 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione?
The canonical SMILES for 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione is O=c1ccn(C2CNCS2)c(=O)[nH]1.
What is the InChIKey of 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione?
The InChIKey is MMALYWALQDLQIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2S/c11-5-1-2-10(7(12)9-5)6-3-8-4-13-6/h1-2,6,8H,3-4H2,(H,9,11,12).
What are the key properties of 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione?
1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione has a molecular weight of 199.23 g/mol, XLogP of -0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazolidin-5-yl)pyrimidine-2,4-dione is sourced from PubChem (CID 174864881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).