About 1-benzhydrylimidazole;hydrobromide
1-benzhydrylimidazole;hydrobromide (PubChem CID 174865219) has the molecular formula C16H15BrN2
and a molecular weight of 315.21 g/mol. Its IUPAC name is 1-benzhydrylimidazole;hydrobromide.
Molecular Properties
| Compound Name | 1-benzhydrylimidazole;hydrobromide |
| PubChem CID | 174865219 |
| Molecular Formula | C16H15BrN2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 1-benzhydrylimidazole;hydrobromide |
| SMILES | Br.c1ccc(C(c2ccccc2)n2ccnc2)cc1 |
| InChI | InChI=1S/C16H14N2.BrH/c1-3-7-14(8-4-1)16(18-12-11-17-13-18)15-9-5-2-6-10-15;/h1-13,16H;1H |
| InChIKey | VAJWWDBXKORMHM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzhydrylimidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydrylimidazole;hydrobromide?
The IUPAC name of 1-benzhydrylimidazole;hydrobromide (CID 174865219) is 1-benzhydrylimidazole;hydrobromide.
What is the SMILES notation for 1-benzhydrylimidazole;hydrobromide?
The canonical SMILES for 1-benzhydrylimidazole;hydrobromide is Br.c1ccc(C(c2ccccc2)n2ccnc2)cc1.
What is the InChIKey of 1-benzhydrylimidazole;hydrobromide?
The InChIKey is VAJWWDBXKORMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2.BrH/c1-3-7-14(8-4-1)16(18-12-11-17-13-18)15-9-5-2-6-10-15;/h1-13,16H;1H.
What are the key properties of 1-benzhydrylimidazole;hydrobromide?
1-benzhydrylimidazole;hydrobromide has a molecular weight of 315.21 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydrylimidazole;hydrobromide is sourced from PubChem (CID 174865219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).