About hydroxy-oxo-sulfooxyphosphanium;pyridine
hydroxy-oxo-sulfooxyphosphanium;pyridine (PubChem CID 174865517) has the molecular formula C5H7NO6PS+
and a molecular weight of 240.15 g/mol. Its IUPAC name is hydroxy-oxo-sulfooxyphosphanium;pyridine.
Molecular Properties
| Compound Name | hydroxy-oxo-sulfooxyphosphanium;pyridine |
| PubChem CID | 174865517 |
| Molecular Formula | C5H7NO6PS+ |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | hydroxy-oxo-sulfooxyphosphanium;pyridine |
| SMILES | O=[P+](O)OS(=O)(=O)O.c1ccncc1 |
| InChI | InChI=1S/C5H5N.HO6PS/c1-2-4-6-5-3-1;1-7(2)6-8(3,4)5/h1-5H;(H-,1,2,3,4,5)/p+1 |
| InChIKey | VQHKGQVZYDTSMP-UHFFFAOYSA-O |
| XLogP | 0.54 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-sulfooxyphosphanium;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-sulfooxyphosphanium;pyridine?
The IUPAC name of hydroxy-oxo-sulfooxyphosphanium;pyridine (CID 174865517) is hydroxy-oxo-sulfooxyphosphanium;pyridine.
What is the SMILES notation for hydroxy-oxo-sulfooxyphosphanium;pyridine?
The canonical SMILES for hydroxy-oxo-sulfooxyphosphanium;pyridine is O=[P+](O)OS(=O)(=O)O.c1ccncc1.
What is the InChIKey of hydroxy-oxo-sulfooxyphosphanium;pyridine?
The InChIKey is VQHKGQVZYDTSMP-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H5N.HO6PS/c1-2-4-6-5-3-1;1-7(2)6-8(3,4)5/h1-5H;(H-,1,2,3,4,5)/p+1.
What are the key properties of hydroxy-oxo-sulfooxyphosphanium;pyridine?
hydroxy-oxo-sulfooxyphosphanium;pyridine has a molecular weight of 240.15 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-sulfooxyphosphanium;pyridine is sourced from PubChem (CID 174865517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).