C18H27NO5S — CID 174865805
tert-butyl 3-[(4-ethylphenyl)-sulfinooxymethyl]pyrrolidine-1-carboxylate (PubChem CID 174865805) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is tert-butyl 3-[(4-ethylphenyl)-sulfinooxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-ethylphenyl)-sulfinooxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174865805 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | tert-butyl 3-[(4-ethylphenyl)-sulfinooxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCc1ccc(C(OS(=O)O)C2CCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H27NO5S/c1-5-13-6-8-14(9-7-13)16(24-25(21)22)15-10-11-19(12-15)17(20)23-18(2,3)4/h6-9,15-16H,5,10-12H2,1-4H3,(H,21,22) |
| InChIKey | ONWGASGQBFCNPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|