C15H31NO3 — CID 174865943
tert-butyl 3-(hydroxymethyl)azetidine-1-carboxylate;2-methylpentane (PubChem CID 174865943) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)azetidine-1-carboxylate;2-methylpentane.
| Compound Name | tert-butyl 3-(hydroxymethyl)azetidine-1-carboxylate;2-methylpentane |
|---|---|
| PubChem CID | 174865943 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)azetidine-1-carboxylate;2-methylpentane |
| SMILES | CC(C)(C)OC(=O)N1CC(CO)C1.CCCC(C)C |
| InChI | InChI=1S/C9H17NO3.C6H14/c1-9(2,3)13-8(12)10-4-7(5-10)6-11;1-4-5-6(2)3/h7,11H,4-6H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | OXYVXODVZQUPRX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |