About 3-fluoropropyl 2H-pyrimidine-1-carboxylate
3-fluoropropyl 2H-pyrimidine-1-carboxylate (PubChem CID 174865979) has the molecular formula C8H11FN2O2
and a molecular weight of 186.19 g/mol. Its IUPAC name is 3-fluoropropyl 2H-pyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | 3-fluoropropyl 2H-pyrimidine-1-carboxylate |
| PubChem CID | 174865979 |
| Molecular Formula | C8H11FN2O2 |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-fluoropropyl 2H-pyrimidine-1-carboxylate |
| SMILES | O=C(OCCCF)N1C=CC=NC1 |
| InChI | InChI=1S/C8H11FN2O2/c9-3-1-6-13-8(12)11-5-2-4-10-7-11/h2,4-5H,1,3,6-7H2 |
| InChIKey | DJXGBELRGDIRCV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropropyl 2H-pyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropropyl 2H-pyrimidine-1-carboxylate?
The IUPAC name of 3-fluoropropyl 2H-pyrimidine-1-carboxylate (CID 174865979) is 3-fluoropropyl 2H-pyrimidine-1-carboxylate.
What is the SMILES notation for 3-fluoropropyl 2H-pyrimidine-1-carboxylate?
The canonical SMILES for 3-fluoropropyl 2H-pyrimidine-1-carboxylate is O=C(OCCCF)N1C=CC=NC1.
What is the InChIKey of 3-fluoropropyl 2H-pyrimidine-1-carboxylate?
The InChIKey is DJXGBELRGDIRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O2/c9-3-1-6-13-8(12)11-5-2-4-10-7-11/h2,4-5H,1,3,6-7H2.
What are the key properties of 3-fluoropropyl 2H-pyrimidine-1-carboxylate?
3-fluoropropyl 2H-pyrimidine-1-carboxylate has a molecular weight of 186.19 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropropyl 2H-pyrimidine-1-carboxylate is sourced from PubChem (CID 174865979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).