About 1-benzofuran;oxadiazole;thiophene
1-benzofuran;oxadiazole;thiophene (PubChem CID 174866039) has the molecular formula C14H12N2O2S
and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-benzofuran;oxadiazole;thiophene.
Molecular Properties
| Compound Name | 1-benzofuran;oxadiazole;thiophene |
| PubChem CID | 174866039 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-benzofuran;oxadiazole;thiophene |
| SMILES | c1ccc2occc2c1.c1ccsc1.c1conn1 |
| InChI | InChI=1S/C8H6O.C4H4S.C2H2N2O/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-3-1;1-2-5-4-3-1/h1-6H;1-4H;1-2H |
| InChIKey | RFCIDFXUCNZGDG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzofuran;oxadiazole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;oxadiazole;thiophene?
The IUPAC name of 1-benzofuran;oxadiazole;thiophene (CID 174866039) is 1-benzofuran;oxadiazole;thiophene.
What is the SMILES notation for 1-benzofuran;oxadiazole;thiophene?
The canonical SMILES for 1-benzofuran;oxadiazole;thiophene is c1ccc2occc2c1.c1ccsc1.c1conn1.
What is the InChIKey of 1-benzofuran;oxadiazole;thiophene?
The InChIKey is RFCIDFXUCNZGDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C4H4S.C2H2N2O/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-3-1;1-2-5-4-3-1/h1-6H;1-4H;1-2H.
What are the key properties of 1-benzofuran;oxadiazole;thiophene?
1-benzofuran;oxadiazole;thiophene has a molecular weight of 272.33 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;oxadiazole;thiophene is sourced from PubChem (CID 174866039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).