About anthracene;cyclohexa-2,4-dien-1-one
anthracene;cyclohexa-2,4-dien-1-one (PubChem CID 174866475) has the molecular formula C20H16O
and a molecular weight of 272.35 g/mol. Its IUPAC name is anthracene;cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | anthracene;cyclohexa-2,4-dien-1-one |
| PubChem CID | 174866475 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | anthracene;cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C6H6O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-6-4-2-1-3-5-6/h1-10H;1-4H,5H2 |
| InChIKey | VFFZKDMCGFGNIR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;cyclohexa-2,4-dien-1-one?
The IUPAC name of anthracene;cyclohexa-2,4-dien-1-one (CID 174866475) is anthracene;cyclohexa-2,4-dien-1-one.
What is the SMILES notation for anthracene;cyclohexa-2,4-dien-1-one?
The canonical SMILES for anthracene;cyclohexa-2,4-dien-1-one is O=C1C=CC=CC1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;cyclohexa-2,4-dien-1-one?
The InChIKey is VFFZKDMCGFGNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C6H6O/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-6-4-2-1-3-5-6/h1-10H;1-4H,5H2.
What are the key properties of anthracene;cyclohexa-2,4-dien-1-one?
anthracene;cyclohexa-2,4-dien-1-one has a molecular weight of 272.35 g/mol, XLogP of 5.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 174866475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).