About diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane
diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane (PubChem CID 174866576) has the molecular formula C17H38O10
and a molecular weight of 402.48 g/mol. Its IUPAC name is diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane.
Molecular Properties
| Compound Name | diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane |
| PubChem CID | 174866576 |
| Molecular Formula | C17H38O10 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane |
| SMILES | CCOC(=O)OCC.COCCOCCOC.OCCOCCOCCO |
| InChI | InChI=1S/C6H14O4.C6H14O3.C5H10O3/c7-1-3-9-5-6-10-4-2-8;1-7-3-5-9-6-4-8-2;1-3-7-5(6)8-4-2/h7-8H,1-6H2;3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | NFQAGTOYLKICTI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane?
The IUPAC name of diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane (CID 174866576) is diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane.
What is the SMILES notation for diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane?
The canonical SMILES for diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane is CCOC(=O)OCC.COCCOCCOC.OCCOCCOCCO.
What is the InChIKey of diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane?
The InChIKey is NFQAGTOYLKICTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O4.C6H14O3.C5H10O3/c7-1-3-9-5-6-10-4-2-8;1-7-3-5-9-6-4-8-2;1-3-7-5(6)8-4-2/h7-8H,1-6H2;3-6H2,1-2H3;3-4H2,1-2H3.
What are the key properties of diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane?
diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane has a molecular weight of 402.48 g/mol, XLogP of 0.48, 15 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl carbonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-methoxy-2-(2-methoxyethoxy)ethane is sourced from PubChem (CID 174866576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).