C23H33Cl2NO3 — CID 174867255
3-[2-[2-(2,4-dichloroheptyl)phenyl]heptanoyl]-1,3-oxazolidin-2-one (PubChem CID 174867255) has the molecular formula C23H33Cl2NO3 and a molecular weight of 442.43 g/mol. Its IUPAC name is 3-[2-[2-(2,4-dichloroheptyl)phenyl]heptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-[2-(2,4-dichloroheptyl)phenyl]heptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 174867255 |
| Molecular Formula | C23H33Cl2NO3 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 3-[2-[2-(2,4-dichloroheptyl)phenyl]heptanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCC(C(=O)N1CCOC1=O)c1ccccc1CC(Cl)CC(Cl)CCC |
| InChI | InChI=1S/C23H33Cl2NO3/c1-3-5-6-12-21(22(27)26-13-14-29-23(26)28)20-11-8-7-10-17(20)15-19(25)16-18(24)9-4-2/h7-8,10-11,18-19,21H,3-6,9,12-16H2,1-2H3 |
| InChIKey | MTUQVMAVNIVOGE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|