C33H55F3N8O3S — CID 174867268
2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl trifluoromethanesulfonate (PubChem CID 174867268) has the molecular formula C33H55F3N8O3S and a molecular weight of 700.92 g/mol. Its IUPAC name is 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl trifluoromethanesulfonate.
| Compound Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 174867268 |
| Molecular Formula | C33H55F3N8O3S |
| Molecular Weight | 700.92 g/mol |
| Exact Mass | 700.41 |
| IUPAC Name | 2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C12)C1CCCCC61)C1CCCCC51)C1CCCCC41)C(F)(F)F |
| InChI | InChI=1S/C33H55F3N8O3S/c34-33(35,36)48(45,46)47-23-15-7-14-22-24(23)32-43-30-21-13-6-5-12-20(21)28(41-30)39-26-17-9-2-1-8-16(17)25(37-26)38-27-18-10-3-4-11-19(18)29(40-27)42-31(22)44-32/h16-32,37-44H,1-15H2 |
| InChIKey | BRNZHOGKFLLRSC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.92 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|