C17H39N7O2 — CID 174868456
1-amino-1-[5-[amino(carbamoyl)amino]-2-methylpentyl]urea;3,3,5-trimethylcyclohexan-1-amine (PubChem CID 174868456) has the molecular formula C17H39N7O2 and a molecular weight of 373.55 g/mol. Its IUPAC name is 1-amino-1-[5-[amino(carbamoyl)amino]-2-methylpentyl]urea;3,3,5-trimethylcyclohexan-1-amine.
| Compound Name | 1-amino-1-[5-[amino(carbamoyl)amino]-2-methylpentyl]urea;3,3,5-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 174868456 |
| Molecular Formula | C17H39N7O2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | 1-amino-1-[5-[amino(carbamoyl)amino]-2-methylpentyl]urea;3,3,5-trimethylcyclohexan-1-amine |
| SMILES | CC(CCCN(N)C(N)=O)CN(N)C(N)=O.CC1CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C9H19N.C8H20N6O2/c1-7-4-8(10)6-9(2,3)5-7;1-6(5-14(12)8(10)16)3-2-4-13(11)7(9)15/h7-8H,4-6,10H2,1-3H3;6H,2-5,11-12H2,1H3,(H2,9,15)(H2,10,16) |
| InChIKey | FMXFACUBQOWOFA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 170.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|