About 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid
3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid (PubChem CID 174868829) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid |
| PubChem CID | 174868829 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid |
| SMILES | CC(CC1=NCCO1)C(=O)O |
| InChI | InChI=1S/C7H11NO3/c1-5(7(9)10)4-6-8-2-3-11-6/h5H,2-4H2,1H3,(H,9,10) |
| InChIKey | HJIRCUAJGMYUIT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid (CID 174868829) is 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid is CC(CC1=NCCO1)C(=O)O.
What is the InChIKey of 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid?
The InChIKey is HJIRCUAJGMYUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-5(7(9)10)4-6-8-2-3-11-6/h5H,2-4H2,1H3,(H,9,10).
What are the key properties of 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid?
3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid has a molecular weight of 157.17 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1,3-oxazol-2-yl)-2-methylpropanoic acid is sourced from PubChem (CID 174868829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).