C16H21ClN2O — CID 174868921
2-(3-chloropropyl)morpholine;quinoline (PubChem CID 174868921) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-(3-chloropropyl)morpholine;quinoline.
| Compound Name | 2-(3-chloropropyl)morpholine;quinoline |
|---|---|
| PubChem CID | 174868921 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(3-chloropropyl)morpholine;quinoline |
| SMILES | ClCCCC1CNCCO1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H14ClNO/c1-2-6-9-8(4-1)5-3-7-10-9;8-3-1-2-7-6-9-4-5-10-7/h1-7H;7,9H,1-6H2 |
| InChIKey | BVOVJARZUSPSKR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|