About methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate
methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate (PubChem CID 174869062) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate |
| PubChem CID | 174869062 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC(C)(C)N1c1ccccc1C |
| InChI | InChI=1S/C16H23NO2/c1-12-8-6-7-9-13(12)17-15(2,3)10-11-16(17,4)14(18)19-5/h6-9H,10-11H2,1-5H3/t16-/m1/s1 |
| InChIKey | LMVWLVOFRXGNFH-MRXNPFEDSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate?
The IUPAC name of methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate (CID 174869062) is methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate is COC(=O)[C@@]1(C)CCC(C)(C)N1c1ccccc1C.
What is the InChIKey of methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate?
The InChIKey is LMVWLVOFRXGNFH-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H23NO2/c1-12-8-6-7-9-13(12)17-15(2,3)10-11-16(17,4)14(18)19-5/h6-9H,10-11H2,1-5H3/t16-/m1/s1.
What are the key properties of methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate?
methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate has a molecular weight of 261.37 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2,5,5-trimethyl-1-(2-methylphenyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 174869062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).