About phenyl 4-hydroxyoctanoate
phenyl 4-hydroxyoctanoate (PubChem CID 174869154) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is phenyl 4-hydroxyoctanoate.
Molecular Properties
| Compound Name | phenyl 4-hydroxyoctanoate |
| PubChem CID | 174869154 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | phenyl 4-hydroxyoctanoate |
| SMILES | CCCCC(O)CCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-2-3-7-12(15)10-11-14(16)17-13-8-5-4-6-9-13/h4-6,8-9,12,15H,2-3,7,10-11H2,1H3 |
| InChIKey | IGWRPYAMBGFVDZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 4-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-hydroxyoctanoate?
The IUPAC name of phenyl 4-hydroxyoctanoate (CID 174869154) is phenyl 4-hydroxyoctanoate.
What is the SMILES notation for phenyl 4-hydroxyoctanoate?
The canonical SMILES for phenyl 4-hydroxyoctanoate is CCCCC(O)CCC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 4-hydroxyoctanoate?
The InChIKey is IGWRPYAMBGFVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-2-3-7-12(15)10-11-14(16)17-13-8-5-4-6-9-13/h4-6,8-9,12,15H,2-3,7,10-11H2,1H3.
What are the key properties of phenyl 4-hydroxyoctanoate?
phenyl 4-hydroxyoctanoate has a molecular weight of 236.31 g/mol, XLogP of 2.92, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-hydroxyoctanoate is sourced from PubChem (CID 174869154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).