C10H7N3O2 — CID 174869788
cyclohexa-2,5-diene-1,4-dione;imidazole-1-carbonitrile (PubChem CID 174869788) has the molecular formula C10H7N3O2 and a molecular weight of 201.19 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;imidazole-1-carbonitrile.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;imidazole-1-carbonitrile |
|---|---|
| PubChem CID | 174869788 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;imidazole-1-carbonitrile |
| SMILES | N#Cn1ccnc1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.C4H3N3/c7-5-1-2-6(8)4-3-5;5-3-7-2-1-6-4-7/h1-4H;1-2,4H |
| InChIKey | FMWISKIWKYDUEJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|