About [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone
[(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 174870276) has the molecular formula C9H10F2N2OS
and a molecular weight of 232.25 g/mol. Its IUPAC name is [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone |
| PubChem CID | 174870276 |
| Molecular Formula | C9H10F2N2OS |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | C[C@H]1CC(F)(F)CN1C(=O)c1cscn1 |
| InChI | InChI=1S/C9H10F2N2OS/c1-6-2-9(10,11)4-13(6)8(14)7-3-15-5-12-7/h3,5-6H,2,4H2,1H3/t6-/m0/s1 |
| InChIKey | CAQGJGWVQYYKBQ-LURJTMIESA-N |
| XLogP | 2.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone?
The IUPAC name of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone (CID 174870276) is [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone?
The canonical SMILES for [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone is C[C@H]1CC(F)(F)CN1C(=O)c1cscn1.
What is the InChIKey of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone?
The InChIKey is CAQGJGWVQYYKBQ-LURJTMIESA-N. The full InChI is InChI=1S/C9H10F2N2OS/c1-6-2-9(10,11)4-13(6)8(14)7-3-15-5-12-7/h3,5-6H,2,4H2,1H3/t6-/m0/s1.
What are the key properties of [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone?
[(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone has a molecular weight of 232.25 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4,4-difluoro-2-methylpyrrolidin-1-yl]-(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 174870276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).