C16H27NO8 — CID 174871339
[4-[3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl]-1-hydroxybutyl] nitrate (PubChem CID 174871339) has the molecular formula C16H27NO8 and a molecular weight of 361.39 g/mol. Its IUPAC name is [4-[3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl]-1-hydroxybutyl] nitrate.
| Compound Name | [4-[3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl]-1-hydroxybutyl] nitrate |
|---|---|
| PubChem CID | 174871339 |
| Molecular Formula | C16H27NO8 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [4-[3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]cyclohexyl]-1-hydroxybutyl] nitrate |
| SMILES | O=[N+]([O-])OC(O)CCCC1CCCC([C@@]2(O)CO[C@@H]3[C@H](O)CO[C@@H]32)C1 |
| InChI | InChI=1S/C16H27NO8/c18-12-8-23-15-14(12)24-9-16(15,20)11-5-1-3-10(7-11)4-2-6-13(19)25-17(21)22/h10-15,18-20H,1-9H2/t10?,11?,12-,13?,14-,15+,16+/m1/s1 |
| InChIKey | JWJMNBSKWNNDNN-OQGMWWFOSA-N |
| XLogP | 0.38 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|