C16H15N2NaO5S — CID 174871470
sodium;1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-sulfonic acid;hydride (PubChem CID 174871470) has the molecular formula C16H15N2NaO5S and a molecular weight of 370.36 g/mol. Its IUPAC name is sodium;1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-sulfonic acid;hydride.
| Compound Name | sodium;1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 174871470 |
| Molecular Formula | C16H15N2NaO5S |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | sodium;1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-sulfonic acid;hydride |
| SMILES | CCNc1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O.[H-].[Na+] |
| InChI | InChI=1S/C16H14N2O5S.Na.H/c1-2-18-10-7-11(24(21,22)23)14(17)13-12(10)15(19)8-5-3-4-6-9(8)16(13)20;;/h3-7,18H,2,17H2,1H3,(H,21,22,23);;/q;+1;-1 |
| InChIKey | VORZTFGPESHXQO-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|