C4HF8LiO4S2-2 — CID 174871743
lithium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfinate (PubChem CID 174871743) has the molecular formula C4HF8LiO4S2-2 and a molecular weight of 336.11 g/mol. Its IUPAC name is lithium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfinate.
| Compound Name | lithium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfinate |
|---|---|
| PubChem CID | 174871743 |
| Molecular Formula | C4HF8LiO4S2-2 |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | lithium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)[O-].[H-].[Li+] |
| InChI | InChI=1S/C4H2F8O4S2.Li.H/c5-1(6,3(9,10)17(13)14)2(7,8)4(11,12)18(15)16;;/h(H,13,14)(H,15,16);;/q;+1;-1/p-2 |
| InChIKey | ZWAYYAJUUQODAD-UHFFFAOYSA-L |
| XLogP | -1.68 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|