About 2,3-dimethylbutane tetrafluoroborate
2,3-dimethylbutane tetrafluoroborate (PubChem CID 174871894) has the molecular formula C6H14BF4-
and a molecular weight of 172.98 g/mol. Its IUPAC name is 2,3-dimethylbutane tetrafluoroborate.
Molecular Properties
| Compound Name | 2,3-dimethylbutane tetrafluoroborate |
| PubChem CID | 174871894 |
| Molecular Formula | C6H14BF4- |
| Molecular Weight | 172.98 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2,3-dimethylbutane tetrafluoroborate |
| SMILES | CC(C)C(C)C.F[B-](F)(F)F |
| InChI | InChI=1S/C6H14.BF4/c1-5(2)6(3)4;2-1(3,4)5/h5-6H,1-4H3;/q;-1 |
| InChIKey | ZWCMPPGHQVCIRH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.98 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutane tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane tetrafluoroborate?
The IUPAC name of 2,3-dimethylbutane tetrafluoroborate (CID 174871894) is 2,3-dimethylbutane tetrafluoroborate.
What is the SMILES notation for 2,3-dimethylbutane tetrafluoroborate?
The canonical SMILES for 2,3-dimethylbutane tetrafluoroborate is CC(C)C(C)C.F[B-](F)(F)F.
What is the InChIKey of 2,3-dimethylbutane tetrafluoroborate?
The InChIKey is ZWCMPPGHQVCIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.BF4/c1-5(2)6(3)4;2-1(3,4)5/h5-6H,1-4H3;/q;-1.
What are the key properties of 2,3-dimethylbutane tetrafluoroborate?
2,3-dimethylbutane tetrafluoroborate has a molecular weight of 172.98 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane tetrafluoroborate is sourced from PubChem (CID 174871894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).