About azane;2-nitro-N-propan-2-ylaniline
azane;2-nitro-N-propan-2-ylaniline (PubChem CID 174872000) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is azane;2-nitro-N-propan-2-ylaniline.
Molecular Properties
| Compound Name | azane;2-nitro-N-propan-2-ylaniline |
| PubChem CID | 174872000 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | azane;2-nitro-N-propan-2-ylaniline |
| SMILES | CC(C)Nc1ccccc1[N+](=O)[O-].N |
| InChI | InChI=1S/C9H12N2O2.H3N/c1-7(2)10-8-5-3-4-6-9(8)11(12)13;/h3-7,10H,1-2H3;1H3 |
| InChIKey | WZPBMGYPPOXYJK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;2-nitro-N-propan-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-nitro-N-propan-2-ylaniline?
The IUPAC name of azane;2-nitro-N-propan-2-ylaniline (CID 174872000) is azane;2-nitro-N-propan-2-ylaniline.
What is the SMILES notation for azane;2-nitro-N-propan-2-ylaniline?
The canonical SMILES for azane;2-nitro-N-propan-2-ylaniline is CC(C)Nc1ccccc1[N+](=O)[O-].N.
What is the InChIKey of azane;2-nitro-N-propan-2-ylaniline?
The InChIKey is WZPBMGYPPOXYJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.H3N/c1-7(2)10-8-5-3-4-6-9(8)11(12)13;/h3-7,10H,1-2H3;1H3.
What are the key properties of azane;2-nitro-N-propan-2-ylaniline?
azane;2-nitro-N-propan-2-ylaniline has a molecular weight of 197.24 g/mol, XLogP of 2.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-nitro-N-propan-2-ylaniline is sourced from PubChem (CID 174872000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).