About 3,4-dichloroaniline;1,2-xylene
3,4-dichloroaniline;1,2-xylene (PubChem CID 174872012) has the molecular formula C14H15Cl2N
and a molecular weight of 268.19 g/mol. Its IUPAC name is 3,4-dichloroaniline;1,2-xylene.
Molecular Properties
| Compound Name | 3,4-dichloroaniline;1,2-xylene |
| PubChem CID | 174872012 |
| Molecular Formula | C14H15Cl2N |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3,4-dichloroaniline;1,2-xylene |
| SMILES | Cc1ccccc1C.Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H10.C6H5Cl2N/c1-7-5-3-4-6-8(7)2;7-5-2-1-4(9)3-6(5)8/h3-6H,1-2H3;1-3H,9H2 |
| InChIKey | QLJOQUMLBCXKRM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloroaniline;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloroaniline;1,2-xylene?
The IUPAC name of 3,4-dichloroaniline;1,2-xylene (CID 174872012) is 3,4-dichloroaniline;1,2-xylene.
What is the SMILES notation for 3,4-dichloroaniline;1,2-xylene?
The canonical SMILES for 3,4-dichloroaniline;1,2-xylene is Cc1ccccc1C.Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3,4-dichloroaniline;1,2-xylene?
The InChIKey is QLJOQUMLBCXKRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C6H5Cl2N/c1-7-5-3-4-6-8(7)2;7-5-2-1-4(9)3-6(5)8/h3-6H,1-2H3;1-3H,9H2.
What are the key properties of 3,4-dichloroaniline;1,2-xylene?
3,4-dichloroaniline;1,2-xylene has a molecular weight of 268.19 g/mol, XLogP of 4.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloroaniline;1,2-xylene is sourced from PubChem (CID 174872012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).