C13H24O — CID 174872604
(1S,2S,4S)-1,2,3,3,7,7-hexamethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 174872604) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (1S,2S,4S)-1,2,3,3,7,7-hexamethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,2S,4S)-1,2,3,3,7,7-hexamethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 174872604 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (1S,2S,4S)-1,2,3,3,7,7-hexamethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@@](C)(C2(C)C)[C@@]1(C)O |
| InChI | InChI=1S/C13H24O/c1-10(2)9-7-8-12(10,5)13(6,14)11(9,3)4/h9,14H,7-8H2,1-6H3/t9-,12-,13-/m0/s1 |
| InChIKey | QISQLHCPXMGUHW-XDTLVQLUSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |