C14H23NO4 — CID 174872824
methyl 2-[cyclobut-2-en-1-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate (PubChem CID 174872824) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl 2-[cyclobut-2-en-1-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[cyclobut-2-en-1-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 174872824 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | methyl 2-[cyclobut-2-en-1-yl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)N(C(=O)OC(C)(C)C)C1C=CC1 |
| InChI | InChI=1S/C14H23NO4/c1-13(2,3)19-12(17)15(10-8-7-9-10)14(4,5)11(16)18-6/h7-8,10H,9H2,1-6H3 |
| InChIKey | SZSAJAVHOVHLAL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|