About 2-methoxyethanol;pentan-2-one
2-methoxyethanol;pentan-2-one (PubChem CID 174873193) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-methoxyethanol;pentan-2-one.
Molecular Properties
| Compound Name | 2-methoxyethanol;pentan-2-one |
| PubChem CID | 174873193 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 2-methoxyethanol;pentan-2-one |
| SMILES | CCCC(C)=O.COCCO |
| InChI | InChI=1S/C5H10O.C3H8O2/c1-3-4-5(2)6;1-5-3-2-4/h3-4H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | IIXBLAUDFRPASV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxyethanol;pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethanol;pentan-2-one?
The IUPAC name of 2-methoxyethanol;pentan-2-one (CID 174873193) is 2-methoxyethanol;pentan-2-one.
What is the SMILES notation for 2-methoxyethanol;pentan-2-one?
The canonical SMILES for 2-methoxyethanol;pentan-2-one is CCCC(C)=O.COCCO.
What is the InChIKey of 2-methoxyethanol;pentan-2-one?
The InChIKey is IIXBLAUDFRPASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C3H8O2/c1-3-4-5(2)6;1-5-3-2-4/h3-4H2,1-2H3;4H,2-3H2,1H3.
What are the key properties of 2-methoxyethanol;pentan-2-one?
2-methoxyethanol;pentan-2-one has a molecular weight of 162.23 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethanol;pentan-2-one is sourced from PubChem (CID 174873193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).