About morpholine;4-(trifluoromethyl)pyrrolidin-2-one
morpholine;4-(trifluoromethyl)pyrrolidin-2-one (PubChem CID 174873213) has the molecular formula C9H15F3N2O2
and a molecular weight of 240.22 g/mol. Its IUPAC name is morpholine;4-(trifluoromethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | morpholine;4-(trifluoromethyl)pyrrolidin-2-one |
| PubChem CID | 174873213 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | morpholine;4-(trifluoromethyl)pyrrolidin-2-one |
| SMILES | C1COCCN1.O=C1CC(C(F)(F)F)CN1 |
| InChI | InChI=1S/C5H6F3NO.C4H9NO/c6-5(7,8)3-1-4(10)9-2-3;1-3-6-4-2-5-1/h3H,1-2H2,(H,9,10);5H,1-4H2 |
| InChIKey | IKERXPKWNXPCRW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze morpholine;4-(trifluoromethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;4-(trifluoromethyl)pyrrolidin-2-one?
The IUPAC name of morpholine;4-(trifluoromethyl)pyrrolidin-2-one (CID 174873213) is morpholine;4-(trifluoromethyl)pyrrolidin-2-one.
What is the SMILES notation for morpholine;4-(trifluoromethyl)pyrrolidin-2-one?
The canonical SMILES for morpholine;4-(trifluoromethyl)pyrrolidin-2-one is C1COCCN1.O=C1CC(C(F)(F)F)CN1.
What is the InChIKey of morpholine;4-(trifluoromethyl)pyrrolidin-2-one?
The InChIKey is IKERXPKWNXPCRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F3NO.C4H9NO/c6-5(7,8)3-1-4(10)9-2-3;1-3-6-4-2-5-1/h3H,1-2H2,(H,9,10);5H,1-4H2.
What are the key properties of morpholine;4-(trifluoromethyl)pyrrolidin-2-one?
morpholine;4-(trifluoromethyl)pyrrolidin-2-one has a molecular weight of 240.22 g/mol, XLogP of 0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;4-(trifluoromethyl)pyrrolidin-2-one is sourced from PubChem (CID 174873213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).