About lithium;hydride;1,3,5-triethylbenzene
lithium;hydride;1,3,5-triethylbenzene (PubChem CID 174873379) has the molecular formula C12H19Li
and a molecular weight of 170.23 g/mol. Its IUPAC name is lithium;hydride;1,3,5-triethylbenzene.
Molecular Properties
| Compound Name | lithium;hydride;1,3,5-triethylbenzene |
| PubChem CID | 174873379 |
| Molecular Formula | C12H19Li |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.16 |
| IUPAC Name | lithium;hydride;1,3,5-triethylbenzene |
| SMILES | CCc1cc(CC)cc(CC)c1.[H-].[Li+] |
| InChI | InChI=1S/C12H18.Li.H/c1-4-10-7-11(5-2)9-12(6-3)8-10;;/h7-9H,4-6H2,1-3H3;;/q;+1;-1 |
| InChIKey | JYUXLBWUOXOLPV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze lithium;hydride;1,3,5-triethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1,3,5-triethylbenzene?
The IUPAC name of lithium;hydride;1,3,5-triethylbenzene (CID 174873379) is lithium;hydride;1,3,5-triethylbenzene.
What is the SMILES notation for lithium;hydride;1,3,5-triethylbenzene?
The canonical SMILES for lithium;hydride;1,3,5-triethylbenzene is CCc1cc(CC)cc(CC)c1.[H-].[Li+].
What is the InChIKey of lithium;hydride;1,3,5-triethylbenzene?
The InChIKey is JYUXLBWUOXOLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.Li.H/c1-4-10-7-11(5-2)9-12(6-3)8-10;;/h7-9H,4-6H2,1-3H3;;/q;+1;-1.
What are the key properties of lithium;hydride;1,3,5-triethylbenzene?
lithium;hydride;1,3,5-triethylbenzene has a molecular weight of 170.23 g/mol, XLogP of 0.49, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1,3,5-triethylbenzene is sourced from PubChem (CID 174873379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).