About 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one
1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one (PubChem CID 174873482) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one |
| PubChem CID | 174873482 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)C1CN(C)CCO1.C=CN1CCCCC1=O |
| InChI | InChI=1S/C8H13NO2.C7H11NO/c1-3-7(10)8-6-9(2)4-5-11-8;1-2-8-6-4-3-5-7(8)9/h3,8H,1,4-6H2,2H3;2H,1,3-6H2 |
| InChIKey | HSUBVABQVSODFU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one?
The IUPAC name of 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one (CID 174873482) is 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one.
What is the SMILES notation for 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one?
The canonical SMILES for 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one is C=CC(=O)C1CN(C)CCO1.C=CN1CCCCC1=O.
What is the InChIKey of 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one?
The InChIKey is HSUBVABQVSODFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.C7H11NO/c1-3-7(10)8-6-9(2)4-5-11-8;1-2-8-6-4-3-5-7(8)9/h3,8H,1,4-6H2,2H3;2H,1,3-6H2.
What are the key properties of 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one?
1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one has a molecular weight of 280.37 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylpiperidin-2-one;1-(4-methylmorpholin-2-yl)prop-2-en-1-one is sourced from PubChem (CID 174873482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).