C19H21NO4 — CID 174873505
1-methylpyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 174873505) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-methylpyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 1-methylpyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 174873505 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 1-methylpyrrolidin-2-one;2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | CN1CCCC1=O.Cc1cc2cc3c(C)cc(=O)oc3c(C)c2o1 |
| InChI | InChI=1S/C14H12O3.C5H9NO/c1-7-4-12(15)17-14-9(3)13-10(6-11(7)14)5-8(2)16-13;1-6-4-2-3-5(6)7/h4-6H,1-3H3;2-4H2,1H3 |
| InChIKey | HRRHLHAMALUVAF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|