About 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine
2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine (PubChem CID 174873885) has the molecular formula C5H8N6
and a molecular weight of 152.16 g/mol. Its IUPAC name is 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine |
| PubChem CID | 174873885 |
| Molecular Formula | C5H8N6 |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine |
| SMILES | N#C/N=C(\N)NN1CCC=N1 |
| InChI | InChI=1S/C5H8N6/c6-4-8-5(7)10-11-3-1-2-9-11/h2H,1,3H2,(H3,7,8,10) |
| InChIKey | QAKUFPDAYHRORV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine?
The IUPAC name of 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine (CID 174873885) is 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine.
What is the SMILES notation for 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine?
The canonical SMILES for 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine is N#C/N=C(\N)NN1CCC=N1.
What is the InChIKey of 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine?
The InChIKey is QAKUFPDAYHRORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6/c6-4-8-5(7)10-11-3-1-2-9-11/h2H,1,3H2,(H3,7,8,10).
What are the key properties of 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine?
2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine has a molecular weight of 152.16 g/mol, XLogP of -1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-1-(3,4-dihydropyrazol-2-yl)guanidine is sourced from PubChem (CID 174873885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).